Minimum 1
$30.99
Lab Pro Sodium Phosphate, Dibasic is an ACS reagent grade inorganic phosphate supplied as a white solid. It is commonly used in laboratory applications, particularly in conjunction with sodium phosphate monobasic, for the preparation of biological and analytical buffer solutions.
The compound is water soluble and exhibits a pH range of approximately 8.7–9.3 in aqueous solution, making it suitable for controlled buffer systems and biochemical research workflows.
| Chemical Name | Sodium phosphate, dibasic |
| Linear Formula | Na₂HPO₄ |
| CAS Number | 7558-79-4 |
| Molecular Weight | 141.96 g/mol |
| MDL Number | MFCD00003496 |
| UNSPSC Code | 12161705 |
| NACRES | NA.25 |
| SMILES | [Na+].[Na+].[H]OP([O-])([O-])=O |
| InChI | 1S/2Na.H3O4P/c;;1-5(2,3)4/h;;(H3,1,2,3,4)/q2*+1;/p-2 |
| InChI Key | BNIILDVGGAEEIG-UHFFFAOYSA-L |
| Form | Solid |
| Color | White |
| Solubility | Soluble in water |
| pH (aqueous) | 8.7–9.3 |
| pKa (25 °C) | 2.15 / 6.82 / 12.38 |
| Insoluble Material | ≤0.01% |
| Heavy Metals | ≤0.001% |
Minimum 1
$30.99
Lab Pro Sodium Phosphate, Dibasic is an ACS reagent grade inorganic phosphate supplied as a white solid. It is commonly used in laboratory applications, particularly in conjunction with sodium phosphate monobasic, for the preparation of biological and analytical buffer solutions.
The compound is water soluble and exhibits a pH range of approximately 8.7–9.3 in aqueous solution, making it suitable for controlled buffer systems and biochemical research workflows.
| Chemical Name | Sodium phosphate, dibasic |
| Linear Formula | Na₂HPO₄ |
| CAS Number | 7558-79-4 |
| Molecular Weight | 141.96 g/mol |
| MDL Number | MFCD00003496 |
| UNSPSC Code | 12161705 |
| NACRES | NA.25 |
| SMILES | [Na+].[Na+].[H]OP([O-])([O-])=O |
| InChI | 1S/2Na.H3O4P/c;;1-5(2,3)4/h;;(H3,1,2,3,4)/q2*+1;/p-2 |
| InChI Key | BNIILDVGGAEEIG-UHFFFAOYSA-L |
| Form | Solid |
| Color | White |
| Solubility | Soluble in water |
| pH (aqueous) | 8.7–9.3 |
| pKa (25 °C) | 2.15 / 6.82 / 12.38 |
| Insoluble Material | ≤0.01% |
| Heavy Metals | ≤0.001% |